C26H33N5O5S — CID 59743370
(3-hydroxyazetidin-1-yl)-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone (PubChem CID 59743370) has the molecular formula C26H33N5O5S and a molecular weight of 527.65 g/mol. Its IUPAC name is (3-hydroxyazetidin-1-yl)-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone.
| Compound Name | (3-hydroxyazetidin-1-yl)-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
|---|---|
| PubChem CID | 59743370 |
| Molecular Formula | C26H33N5O5S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (3-hydroxyazetidin-1-yl)-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
| SMILES | CS(=O)(=O)CCCOc1cccc2c1ccn2-c1ccnc(NC2CCC(C(=O)N3CC(O)C3)CC2)n1 |
| InChI | InChI=1S/C26H33N5O5S/c1-37(34,35)15-3-14-36-23-5-2-4-22-21(23)11-13-31(22)24-10-12-27-26(29-24)28-19-8-6-18(7-9-19)25(33)30-16-20(32)17-30/h2,4-5,10-13,18-20,32H,3,6-9,14-17H2,1H3,(H,27,28,29) |
| InChIKey | IYCZISRKEHIFRM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|