C27H30N6O4S — CID 59743456
[4-[[4-[4-(3-methylsulfonylpropoxy)indazol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]-pyridin-2-ylmethanone (PubChem CID 59743456) has the molecular formula C27H30N6O4S and a molecular weight of 534.64 g/mol. Its IUPAC name is [4-[[4-[4-(3-methylsulfonylpropoxy)indazol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]-pyridin-2-ylmethanone.
| Compound Name | [4-[[4-[4-(3-methylsulfonylpropoxy)indazol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 59743456 |
| Molecular Formula | C27H30N6O4S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | [4-[[4-[4-(3-methylsulfonylpropoxy)indazol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]-pyridin-2-ylmethanone |
| SMILES | CS(=O)(=O)CCCOc1cccc2c1cnn2-c1ccnc(NC2CCC(C(=O)c3ccccn3)CC2)n1 |
| InChI | InChI=1S/C27H30N6O4S/c1-38(35,36)17-5-16-37-24-8-4-7-23-21(24)18-30-33(23)25-13-15-29-27(32-25)31-20-11-9-19(10-12-20)26(34)22-6-2-3-14-28-22/h2-4,6-8,13-15,18-20H,5,9-12,16-17H2,1H3,(H,29,31,32) |
| InChIKey | HNXYZMKDYCOHCU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|