C18H18N6O2 — CID 24812796
[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl] cyanate (PubChem CID 24812796) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is [1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl] cyanate.
| Compound Name | [1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl] cyanate |
|---|---|
| PubChem CID | 24812796 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl] cyanate |
| SMILES | N#COc1cccc2c1cnn2-c1ccnc(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C18H18N6O2/c19-11-26-16-3-1-2-15-14(16)10-21-24(15)17-8-9-20-18(23-17)22-12-4-6-13(25)7-5-12/h1-3,8-10,12-13,25H,4-7H2,(H,20,22,23) |
| InChIKey | HSWFMWBARIYGPY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|