C19H25N7O2S — CID 59743387
1-[2-[[4-(dimethylsulfamoylamino)cyclohexyl]amino]pyrimidin-4-yl]indazole (PubChem CID 59743387) has the molecular formula C19H25N7O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-[2-[[4-(dimethylsulfamoylamino)cyclohexyl]amino]pyrimidin-4-yl]indazole.
| Compound Name | 1-[2-[[4-(dimethylsulfamoylamino)cyclohexyl]amino]pyrimidin-4-yl]indazole |
|---|---|
| PubChem CID | 59743387 |
| Molecular Formula | C19H25N7O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-[2-[[4-(dimethylsulfamoylamino)cyclohexyl]amino]pyrimidin-4-yl]indazole |
| SMILES | CN(C)S(=O)(=O)NC1CCC(Nc2nccc(-n3ncc4ccccc43)n2)CC1 |
| InChI | InChI=1S/C19H25N7O2S/c1-25(2)29(27,28)24-16-9-7-15(8-10-16)22-19-20-12-11-18(23-19)26-17-6-4-3-5-14(17)13-21-26/h3-6,11-13,15-16,24H,7-10H2,1-2H3,(H,20,22,23) |
| InChIKey | HTNUCVRCRQJDMW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |