C18H25N7O5S2 — CID 24823664
N-[4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexyl]methanesulfonamide;methanesulfonic acid (PubChem CID 24823664) has the molecular formula C18H25N7O5S2 and a molecular weight of 483.58 g/mol. Its IUPAC name is N-[4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexyl]methanesulfonamide;methanesulfonic acid.
| Compound Name | N-[4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexyl]methanesulfonamide;methanesulfonic acid |
|---|---|
| PubChem CID | 24823664 |
| Molecular Formula | C18H25N7O5S2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | N-[4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexyl]methanesulfonamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)NC1CCC(Nc2nccc(-n3nnc4ccccc43)n2)CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C17H21N7O2S.CH4O3S/c1-27(25,26)22-13-8-6-12(7-9-13)19-17-18-11-10-16(20-17)24-15-5-3-2-4-14(15)21-23-24;1-5(2,3)4/h2-5,10-13,22H,6-9H2,1H3,(H,18,19,20);1H3,(H,2,3,4) |
| InChIKey | GWWJJLVDQPXDEI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 169.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|