C16H16N6O — CID 59718950
4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexan-1-one (PubChem CID 59718950) has the molecular formula C16H16N6O and a molecular weight of 308.34 g/mol. Its IUPAC name is 4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexan-1-one.
| Compound Name | 4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexan-1-one |
|---|---|
| PubChem CID | 59718950 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexan-1-one |
| SMILES | O=C1CCC(Nc2nccc(-n3nnc4ccccc43)n2)CC1 |
| InChI | InChI=1S/C16H16N6O/c23-12-7-5-11(6-8-12)18-16-17-10-9-15(19-16)22-14-4-2-1-3-13(14)20-21-22/h1-4,9-11H,5-8H2,(H,17,18,19) |
| InChIKey | FMMWXFFAEPBUOJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |