C19H24N6O2 — CID 89276651
4-(benzotriazol-1-yl)-N-[(1S,2R)-2-(ethylperoxymethyl)cyclohexyl]pyrimidin-2-amine (PubChem CID 89276651) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 4-(benzotriazol-1-yl)-N-[(1S,2R)-2-(ethylperoxymethyl)cyclohexyl]pyrimidin-2-amine.
| Compound Name | 4-(benzotriazol-1-yl)-N-[(1S,2R)-2-(ethylperoxymethyl)cyclohexyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 89276651 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 4-(benzotriazol-1-yl)-N-[(1S,2R)-2-(ethylperoxymethyl)cyclohexyl]pyrimidin-2-amine |
| SMILES | CCOOC[C@@H]1CCCC[C@@H]1Nc1nccc(-n2nnc3ccccc32)n1 |
| InChI | InChI=1S/C19H24N6O2/c1-2-26-27-13-14-7-3-4-8-15(14)21-19-20-12-11-18(22-19)25-17-10-6-5-9-16(17)23-24-25/h5-6,9-12,14-15H,2-4,7-8,13H2,1H3,(H,20,21,22)/t14-,15-/m0/s1 |
| InChIKey | YMZCWTVZSSGLBK-GJZGRUSLSA-N |
| XLogP | 3.15 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|