C18H23N7O2S — CID 24823662
N-[4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexyl]-N-methylmethanesulfonamide (PubChem CID 24823662) has the molecular formula C18H23N7O2S and a molecular weight of 401.50 g/mol. Its IUPAC name is N-[4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexyl]-N-methylmethanesulfonamide.
| Compound Name | N-[4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 24823662 |
| Molecular Formula | C18H23N7O2S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-[4-[[4-(benzotriazol-1-yl)pyrimidin-2-yl]amino]cyclohexyl]-N-methylmethanesulfonamide |
| SMILES | CN(C1CCC(Nc2nccc(-n3nnc4ccccc43)n2)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C18H23N7O2S/c1-24(28(2,26)27)14-9-7-13(8-10-14)20-18-19-12-11-17(21-18)25-16-6-4-3-5-15(16)22-23-25/h3-6,11-14H,7-10H2,1-2H3,(H,19,20,21) |
| InChIKey | BSELCVNDTDLSKJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |