C18H24N8O2S — CID 59718933
1-[2-[[4-(dimethylsulfamoylamino)cyclohexyl]amino]pyrimidin-4-yl]benzotriazole (PubChem CID 59718933) has the molecular formula C18H24N8O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 1-[2-[[4-(dimethylsulfamoylamino)cyclohexyl]amino]pyrimidin-4-yl]benzotriazole.
| Compound Name | 1-[2-[[4-(dimethylsulfamoylamino)cyclohexyl]amino]pyrimidin-4-yl]benzotriazole |
|---|---|
| PubChem CID | 59718933 |
| Molecular Formula | C18H24N8O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[2-[[4-(dimethylsulfamoylamino)cyclohexyl]amino]pyrimidin-4-yl]benzotriazole |
| SMILES | CN(C)S(=O)(=O)NC1CCC(Nc2nccc(-n3nnc4ccccc43)n2)CC1 |
| InChI | InChI=1S/C18H24N8O2S/c1-25(2)29(27,28)23-14-9-7-13(8-10-14)20-18-19-12-11-17(21-18)26-16-6-4-3-5-15(16)22-24-26/h3-6,11-14,23H,7-10H2,1-2H3,(H,19,20,21) |
| InChIKey | VWIDJTODOGUOHO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |