C17H19N5O2 — CID 59743385
1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]-2H-indazol-3-one (PubChem CID 59743385) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]-2H-indazol-3-one.
| Compound Name | 1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]-2H-indazol-3-one |
|---|---|
| PubChem CID | 59743385 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]-2H-indazol-3-one |
| SMILES | O=c1[nH]n(-c2ccnc(NC3CCC(O)CC3)n2)c2ccccc12 |
| InChI | InChI=1S/C17H19N5O2/c23-12-7-5-11(6-8-12)19-17-18-10-9-15(20-17)22-14-4-2-1-3-13(14)16(24)21-22/h1-4,9-12,23H,5-8H2,(H,21,24)(H,18,19,20) |
| InChIKey | ZHQZGWACURLZSC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |