C23H30N6O3S — CID 66927065
2-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indazol-1-yl]pyrimidin-2-yl]amino]cyclohexan-1-ol (PubChem CID 66927065) has the molecular formula C23H30N6O3S and a molecular weight of 470.60 g/mol. Its IUPAC name is 2-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indazol-1-yl]pyrimidin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 2-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indazol-1-yl]pyrimidin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 66927065 |
| Molecular Formula | C23H30N6O3S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 2-[[4-[4-(4-methylsulfonylpiperidin-1-yl)indazol-1-yl]pyrimidin-2-yl]amino]cyclohexan-1-ol |
| SMILES | CS(=O)(=O)C1CCN(c2cccc3c2cnn3-c2ccnc(NC3CCCCC3O)n2)CC1 |
| InChI | InChI=1S/C23H30N6O3S/c1-33(31,32)16-10-13-28(14-11-16)19-6-4-7-20-17(19)15-25-29(20)22-9-12-24-23(27-22)26-18-5-2-3-8-21(18)30/h4,6-7,9,12,15-16,18,21,30H,2-3,5,8,10-11,13-14H2,1H3,(H,24,26,27) |
| InChIKey | RFHZGGGYWROMTN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |