C19H22N4O2S — CID 70791802
1-(2-methylpyrimidin-4-yl)-4-(4-methylsulfonylpiperidin-1-yl)indole (PubChem CID 70791802) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 1-(2-methylpyrimidin-4-yl)-4-(4-methylsulfonylpiperidin-1-yl)indole.
| Compound Name | 1-(2-methylpyrimidin-4-yl)-4-(4-methylsulfonylpiperidin-1-yl)indole |
|---|---|
| PubChem CID | 70791802 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-(2-methylpyrimidin-4-yl)-4-(4-methylsulfonylpiperidin-1-yl)indole |
| SMILES | Cc1nccc(-n2ccc3c(N4CCC(S(C)(=O)=O)CC4)cccc32)n1 |
| InChI | InChI=1S/C19H22N4O2S/c1-14-20-10-6-19(21-14)23-13-9-16-17(4-3-5-18(16)23)22-11-7-15(8-12-22)26(2,24)25/h3-6,9-10,13,15H,7-8,11-12H2,1-2H3 |
| InChIKey | DBIRKAOFNGJJOX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |