C20H26N6O2 — CID 123539074
3-[1-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropan-1-ol (PubChem CID 123539074) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 3-[1-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropan-1-ol.
| Compound Name | 3-[1-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 123539074 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 3-[1-[2-[(4-aminocyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropan-1-ol |
| SMILES | NC1CCC(Nc2nccc(-n3ncc4c(OCCCO)cccc43)n2)CC1 |
| InChI | InChI=1S/C20H26N6O2/c21-14-5-7-15(8-6-14)24-20-22-10-9-19(25-20)26-17-3-1-4-18(16(17)13-23-26)28-12-2-11-27/h1,3-4,9-10,13-15,27H,2,5-8,11-12,21H2,(H,22,24,25) |
| InChIKey | WTKKNKZPAJDBDH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|