C14H22N2O — CID 123153923
(2Z)-2-[(2-methylmorpholin-4-yl)methyl]cycloocta-2,4-dien-1-imine (PubChem CID 123153923) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is (2Z)-2-[(2-methylmorpholin-4-yl)methyl]cycloocta-2,4-dien-1-imine.
| Compound Name | (2Z)-2-[(2-methylmorpholin-4-yl)methyl]cycloocta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123153923 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (2Z)-2-[(2-methylmorpholin-4-yl)methyl]cycloocta-2,4-dien-1-imine |
| SMILES | [H]/N=C1CCCC=C/C=C\1CN1CCOC(C)C1 |
| InChI | InChI=1S/C14H22N2O/c1-12-10-16(8-9-17-12)11-13-6-4-2-3-5-7-14(13)15/h2,4,6,12,15H,3,5,7-11H2,1H3/b4-2?,13-6-,15-14+ |
| InChIKey | BFZHQUZXUXBALQ-MZNAJOOASA-N |
| XLogP | 2.39 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|