C15H24N2O — CID 123165362
(2Z)-2-[(3,3-dimethylmorpholin-4-yl)methyl]cycloocta-2,4-dien-1-imine (PubChem CID 123165362) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (2Z)-2-[(3,3-dimethylmorpholin-4-yl)methyl]cycloocta-2,4-dien-1-imine.
| Compound Name | (2Z)-2-[(3,3-dimethylmorpholin-4-yl)methyl]cycloocta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123165362 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (2Z)-2-[(3,3-dimethylmorpholin-4-yl)methyl]cycloocta-2,4-dien-1-imine |
| SMILES | [H]/N=C1CCCC=C/C=C\1CN1CCOCC1(C)C |
| InChI | InChI=1S/C15H24N2O/c1-15(2)12-18-10-9-17(15)11-13-7-5-3-4-6-8-14(13)16/h3,5,7,16H,4,6,8-12H2,1-2H3/b5-3?,13-7-,16-14+ |
| InChIKey | LHRLRVBFKWWBAL-JMZOWWAXSA-N |
| XLogP | 2.78 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|