C13H20N2O — CID 123288093
(2Z)-2-(morpholin-4-ylmethyl)cycloocta-2,4-dien-1-imine (PubChem CID 123288093) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is (2Z)-2-(morpholin-4-ylmethyl)cycloocta-2,4-dien-1-imine.
| Compound Name | (2Z)-2-(morpholin-4-ylmethyl)cycloocta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123288093 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (2Z)-2-(morpholin-4-ylmethyl)cycloocta-2,4-dien-1-imine |
| SMILES | [H]/N=C1CCCC=C/C=C\1CN1CCOCC1 |
| InChI | InChI=1S/C13H20N2O/c14-13-6-4-2-1-3-5-12(13)11-15-7-9-16-10-8-15/h1,3,5,14H,2,4,6-11H2/b3-1?,12-5-,14-13+ |
| InChIKey | ARBXIMCNESWSAQ-LEMQWNIESA-N |
| XLogP | 2.00 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|