C14H22N2O5 — CID 123154038
4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carbonyl]amino]pent-2-enoic acid (PubChem CID 123154038) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carbonyl]amino]pent-2-enoic acid.
| Compound Name | 4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carbonyl]amino]pent-2-enoic acid |
|---|---|
| PubChem CID | 123154038 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carbonyl]amino]pent-2-enoic acid |
| SMILES | CC(C=CC(=O)O)NC(=O)C1CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N2O5/c1-9(5-6-11(17)18)15-12(19)10-7-8-16(10)13(20)21-14(2,3)4/h5-6,9-10H,7-8H2,1-4H3,(H,15,19)(H,17,18) |
| InChIKey | OYXONDKJGSSZIH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|