C39H88O3Si4 — CID 123155642
dimethyl-[1,1,2-triethyl-2-[(1-ethyl-1-trimethylsilylbutoxy)-methyl-octylsilyl]butoxy]-(3-trimethylsilyloxyhexan-3-yl)silane (PubChem CID 123155642) has the molecular formula C39H88O3Si4 and a molecular weight of 717.47 g/mol. Its IUPAC name is dimethyl-[1,1,2-triethyl-2-[(1-ethyl-1-trimethylsilylbutoxy)-methyl-octylsilyl]butoxy]-(3-trimethylsilyloxyhexan-3-yl)silane.
| Compound Name | dimethyl-[1,1,2-triethyl-2-[(1-ethyl-1-trimethylsilylbutoxy)-methyl-octylsilyl]butoxy]-(3-trimethylsilyloxyhexan-3-yl)silane |
|---|---|
| PubChem CID | 123155642 |
| Molecular Formula | C39H88O3Si4 |
| Molecular Weight | 717.47 g/mol |
| Exact Mass | 716.58 |
| IUPAC Name | dimethyl-[1,1,2-triethyl-2-[(1-ethyl-1-trimethylsilylbutoxy)-methyl-octylsilyl]butoxy]-(3-trimethylsilyloxyhexan-3-yl)silane |
| SMILES | CCCCCCCC[Si](C)(OC(CC)(CCC)[Si](C)(C)C)C(CC)(CC)C(CC)(CC)O[Si](C)(C)C(CC)(CCC)O[Si](C)(C)C |
| InChI | InChI=1S/C39H88O3Si4/c1-19-28-29-30-31-32-35-46(18,42-38(26-8,33-20-2)43(10,11)12)37(24-6,25-7)36(22-4,23-5)40-45(16,17)39(27-9,34-21-3)41-44(13,14)15/h19-35H2,1-18H3 |
| InChIKey | NCMZQKNUQDBPQG-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.47 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|