C24H52O2Si — CID 87183103
butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane (PubChem CID 87183103) has the molecular formula C24H52O2Si and a molecular weight of 400.76 g/mol. Its IUPAC name is butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane.
| Compound Name | butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane |
|---|---|
| PubChem CID | 87183103 |
| Molecular Formula | C24H52O2Si |
| Molecular Weight | 400.76 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane |
| SMILES | CCCCO[Si](CCCC)(CCCC)OC(CCC)(C(C)CC)C(C)CC |
| InChI | InChI=1S/C24H52O2Si/c1-9-15-19-25-27(20-16-10-2,21-17-11-3)26-24(18-12-4,22(7)13-5)23(8)14-6/h22-23H,9-21H2,1-8H3 |
| InChIKey | YZAPAHUGETWIEP-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.76 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|