About butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane
butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane (PubChem CID 87183103) has the molecular formula C24H52O2Si
and a molecular weight of 400.76 g/mol. Its IUPAC name is butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane.
Molecular Properties
| Compound Name | butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane |
| PubChem CID | 87183103 |
| Molecular Formula | C24H52O2Si |
| Molecular Weight | 400.76 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane |
| SMILES | CCCCO[Si](CCCC)(CCCC)OC(CCC)(C(C)CC)C(C)CC |
| InChI | InChI=1S/C24H52O2Si/c1-9-15-19-25-27(20-16-10-2,21-17-11-3)26-24(18-12-4,22(7)13-5)23(8)14-6/h22-23H,9-21H2,1-8H3 |
| InChIKey | YZAPAHUGETWIEP-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.76 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane?
The IUPAC name of butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane (CID 87183103) is butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane.
What is the SMILES notation for butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane?
The canonical SMILES for butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane is CCCCO[Si](CCCC)(CCCC)OC(CCC)(C(C)CC)C(C)CC.
What is the InChIKey of butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane?
The InChIKey is YZAPAHUGETWIEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H52O2Si/c1-9-15-19-25-27(20-16-10-2,21-17-11-3)26-24(18-12-4,22(7)13-5)23(8)14-6/h22-23H,9-21H2,1-8H3.
What are the key properties of butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane?
butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane has a molecular weight of 400.76 g/mol, XLogP of 8.49, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butoxy-dibutyl-(3,5-dimethyl-4-propylheptan-4-yl)oxysilane is sourced from PubChem (CID 87183103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).