C21H21FN6O2 — CID 123156314
18-amino-6-fluoro-13-imino-N,2,11-trimethyl-10-oxo-3-oxa-11,17-diazatricyclo[13.3.1.04,9]nonadeca-1(18),4(9),5,7,15(19),16-hexaene-14-carboximidoyl cyanide (PubChem CID 123156314) has the molecular formula C21H21FN6O2 and a molecular weight of 408.44 g/mol. Its IUPAC name is 18-amino-6-fluoro-13-imino-N,2,11-trimethyl-10-oxo-3-oxa-11,17-diazatricyclo[13.3.1.04,9]nonadeca-1(18),4(9),5,7,15(19),16-hexaene-14-carboximidoyl cyanide.
| Compound Name | 18-amino-6-fluoro-13-imino-N,2,11-trimethyl-10-oxo-3-oxa-11,17-diazatricyclo[13.3.1.04,9]nonadeca-1(18),4(9),5,7,15(19),16-hexaene-14-carboximidoyl cyanide |
|---|---|
| PubChem CID | 123156314 |
| Molecular Formula | C21H21FN6O2 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 18-amino-6-fluoro-13-imino-N,2,11-trimethyl-10-oxo-3-oxa-11,17-diazatricyclo[13.3.1.04,9]nonadeca-1(18),4(9),5,7,15(19),16-hexaene-14-carboximidoyl cyanide |
| SMILES | [H]/N=C1\CN(C)C(=O)c2ccc(F)cc2OC(C)c2cc(cnc2N)C1/C(C#N)=N/C |
| InChI | InChI=1S/C21H21FN6O2/c1-11-15-6-12(9-27-20(15)25)19(17(8-23)26-2)16(24)10-28(3)21(29)14-5-4-13(22)7-18(14)30-11/h4-7,9,11,19,24H,10H2,1-3H3,(H2,25,27)/b24-16+,26-17+ |
| InChIKey | XIQUWFPCTNKQLV-SVOBVALRSA-N |
| XLogP | 2.73 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|