C20H21FN4O3S — CID 123390824
O-methyl 18-amino-6-fluoro-13-imino-3,11-dimethyl-10-oxo-2-oxa-11,17-diazatricyclo[13.3.1.04,9]nonadeca-1(18),4(9),5,7,15(19),16-hexaene-14-carbothioate (PubChem CID 123390824) has the molecular formula C20H21FN4O3S and a molecular weight of 416.48 g/mol. Its IUPAC name is O-methyl 18-amino-6-fluoro-13-imino-3,11-dimethyl-10-oxo-2-oxa-11,17-diazatricyclo[13.3.1.04,9]nonadeca-1(18),4(9),5,7,15(19),16-hexaene-14-carbothioate.
| Compound Name | O-methyl 18-amino-6-fluoro-13-imino-3,11-dimethyl-10-oxo-2-oxa-11,17-diazatricyclo[13.3.1.04,9]nonadeca-1(18),4(9),5,7,15(19),16-hexaene-14-carbothioate |
|---|---|
| PubChem CID | 123390824 |
| Molecular Formula | C20H21FN4O3S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | O-methyl 18-amino-6-fluoro-13-imino-3,11-dimethyl-10-oxo-2-oxa-11,17-diazatricyclo[13.3.1.04,9]nonadeca-1(18),4(9),5,7,15(19),16-hexaene-14-carbothioate |
| SMILES | [H]/N=C1\CN(C)C(=O)c2ccc(F)cc2C(C)Oc2cc(cnc2N)C1C(=S)OC |
| InChI | InChI=1S/C20H21FN4O3S/c1-10-14-7-12(21)4-5-13(14)19(26)25(2)9-15(22)17(20(29)27-3)11-6-16(28-10)18(23)24-8-11/h4-8,10,17,22H,9H2,1-3H3,(H2,23,24)/b22-15+ |
| InChIKey | WDBQUZBTMAYGJH-PXLXIMEGSA-N |
| XLogP | 3.11 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|