C24H25FN6O2 — CID 166833518
(8Z,16R)-3-(cyclopropylmethyl)-13-fluoro-9-imino-16-methyl-8-(methylhydrazinylidene)-5,17-dioxa-4,20-diazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),3,10(15),11,13,18,20-octaen-19-amine (PubChem CID 166833518) has the molecular formula C24H25FN6O2 and a molecular weight of 448.50 g/mol. Its IUPAC name is (8Z,16R)-3-(cyclopropylmethyl)-13-fluoro-9-imino-16-methyl-8-(methylhydrazinylidene)-5,17-dioxa-4,20-diazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),3,10(15),11,13,18,20-octaen-19-amine.
| Compound Name | (8Z,16R)-3-(cyclopropylmethyl)-13-fluoro-9-imino-16-methyl-8-(methylhydrazinylidene)-5,17-dioxa-4,20-diazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),3,10(15),11,13,18,20-octaen-19-amine |
|---|---|
| PubChem CID | 166833518 |
| Molecular Formula | C24H25FN6O2 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (8Z,16R)-3-(cyclopropylmethyl)-13-fluoro-9-imino-16-methyl-8-(methylhydrazinylidene)-5,17-dioxa-4,20-diazatetracyclo[16.3.1.02,6.010,15]docosa-1(22),2(6),3,10(15),11,13,18,20-octaen-19-amine |
| SMILES | [H]/N=C1C(=N/NC)\Cc2onc(CC3CC3)c2-c2cnc(N)c(c2)O[C@H](C)c2cc(F)ccc2\1 |
| InChI | InChI=1S/C24H25FN6O2/c1-12-17-9-15(25)5-6-16(17)23(26)19(30-28-2)10-20-22(18(31-33-20)7-13-3-4-13)14-8-21(32-12)24(27)29-11-14/h5-6,8-9,11-13,26,28H,3-4,7,10H2,1-2H3,(H2,27,29)/b26-23-,30-19-/t12-/m1/s1 |
| InChIKey | WKLQANXNSHAVHG-LRPMYZCKSA-N |
| XLogP | 4.05 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|