C16H13ClFN3S2 — CID 123156859
[4-chloro-2-(5-fluoro-3-pyridinyl)-1,3-thiazol-5-yl]-(N-methylanilino)methanethiol (PubChem CID 123156859) has the molecular formula C16H13ClFN3S2 and a molecular weight of 365.89 g/mol. Its IUPAC name is [4-chloro-2-(5-fluoro-3-pyridinyl)-1,3-thiazol-5-yl]-(N-methylanilino)methanethiol.
| Compound Name | [4-chloro-2-(5-fluoro-3-pyridinyl)-1,3-thiazol-5-yl]-(N-methylanilino)methanethiol |
|---|---|
| PubChem CID | 123156859 |
| Molecular Formula | C16H13ClFN3S2 |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | [4-chloro-2-(5-fluoro-3-pyridinyl)-1,3-thiazol-5-yl]-(N-methylanilino)methanethiol |
| SMILES | CN(c1ccccc1)C(S)c1sc(-c2cncc(F)c2)nc1Cl |
| InChI | InChI=1S/C16H13ClFN3S2/c1-21(12-5-3-2-4-6-12)16(22)13-14(17)20-15(23-13)10-7-11(18)9-19-8-10/h2-9,16,22H,1H3 |
| InChIKey | XEUSECZCKJWGFQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|