About 1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine
1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine (PubChem CID 123161019) has the molecular formula C10H19NS
and a molecular weight of 185.34 g/mol. Its IUPAC name is 1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine.
Analyze 1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine?
The IUPAC name of 1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine (CID 123161019) is 1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for 1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine is CCCSC1CN(C)C=CC1C.
What is the InChIKey of 1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine?
The InChIKey is MUHBDXYRWDHICN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NS/c1-4-7-12-10-8-11(3)6-5-9(10)2/h5-6,9-10H,4,7-8H2,1-3H3.
What are the key properties of 1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine?
1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine has a molecular weight of 185.34 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-3-propylsulfanyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 123161019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).