About 5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine
5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine (PubChem CID 90978333) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is 5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine.
Analyze 5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine?
The IUPAC name of 5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine (CID 90978333) is 5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine.
What is the SMILES notation for 5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine?
The canonical SMILES for 5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine is CCCN1C=CC2CSCC2C1.
What is the InChIKey of 5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine?
The InChIKey is XPCXJYSYHPCGPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NS/c1-2-4-11-5-3-9-7-12-8-10(9)6-11/h3,5,9-10H,2,4,6-8H2,1H3.
What are the key properties of 5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine?
5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine has a molecular weight of 183.32 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propyl-3,3a,4,7a-tetrahydro-1H-thieno[3,4-c]pyridine is sourced from PubChem (CID 90978333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).