C23H23F3O3SSi — CID 123161149
(2-benzyl-1,3-diphenylpropan-2-yl)silyl trifluoromethanesulfonate (PubChem CID 123161149) has the molecular formula C23H23F3O3SSi and a molecular weight of 464.58 g/mol. Its IUPAC name is (2-benzyl-1,3-diphenylpropan-2-yl)silyl trifluoromethanesulfonate.
| Compound Name | (2-benzyl-1,3-diphenylpropan-2-yl)silyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 123161149 |
| Molecular Formula | C23H23F3O3SSi |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | (2-benzyl-1,3-diphenylpropan-2-yl)silyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(O[SiH2]C(Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H23F3O3SSi/c24-23(25,26)30(27,28)29-31-22(16-19-10-4-1-5-11-19,17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21/h1-15H,16-18,31H2 |
| InChIKey | YPDFSYLTSPCXLQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|