C15H25NO2 — CID 123162894
3-amino-5-(4-methylhepta-4,6-dienyl)heptane-2,6-dione (PubChem CID 123162894) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-amino-5-(4-methylhepta-4,6-dienyl)heptane-2,6-dione.
| Compound Name | 3-amino-5-(4-methylhepta-4,6-dienyl)heptane-2,6-dione |
|---|---|
| PubChem CID | 123162894 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 3-amino-5-(4-methylhepta-4,6-dienyl)heptane-2,6-dione |
| SMILES | C=CC=C(C)CCCC(CC(N)C(C)=O)C(C)=O |
| InChI | InChI=1S/C15H25NO2/c1-5-7-11(2)8-6-9-14(12(3)17)10-15(16)13(4)18/h5,7,14-15H,1,6,8-10,16H2,2-4H3 |
| InChIKey | KDRZXFVZCMLAAS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|