C21H26F3N4O3+ — CID 123163101
(3S,6S)-4-[5-(2,4-difluorophenyl)-4-fluoro-1,2,5-oxadiazol-5-ium-3-carbonyl]-3,6-bis(2-methylpropyl)piperazin-2-one (PubChem CID 123163101) has the molecular formula C21H26F3N4O3+ and a molecular weight of 439.46 g/mol. Its IUPAC name is (3S,6S)-4-[5-(2,4-difluorophenyl)-4-fluoro-1,2,5-oxadiazol-5-ium-3-carbonyl]-3,6-bis(2-methylpropyl)piperazin-2-one.
| Compound Name | (3S,6S)-4-[5-(2,4-difluorophenyl)-4-fluoro-1,2,5-oxadiazol-5-ium-3-carbonyl]-3,6-bis(2-methylpropyl)piperazin-2-one |
|---|---|
| PubChem CID | 123163101 |
| Molecular Formula | C21H26F3N4O3+ |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (3S,6S)-4-[5-(2,4-difluorophenyl)-4-fluoro-1,2,5-oxadiazol-5-ium-3-carbonyl]-3,6-bis(2-methylpropyl)piperazin-2-one |
| SMILES | CC(C)C[C@H]1CN(C(=O)c2no[n+](-c3ccc(F)cc3F)c2F)[C@@H](CC(C)C)C(=O)N1 |
| InChI | InChI=1S/C21H25F3N4O3/c1-11(2)7-14-10-27(17(8-12(3)4)20(29)25-14)21(30)18-19(24)28(31-26-18)16-6-5-13(22)9-15(16)23/h5-6,9,11-12,14,17H,7-8,10H2,1-4H3/p+1/t14-,17-/m0/s1 |
| InChIKey | PIDPMWWABJQFPG-YOEHRIQHSA-O |
| XLogP | 2.77 |
| TPSA | 79.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|