C23H22F3N4O3+ — CID 123566315
(3S,6S)-4-[5-(2,4-difluorophenyl)-4-fluoro-1,2,5-oxadiazol-5-ium-3-carbonyl]-3-(2-methylpropyl)-6-phenylpiperazin-2-one (PubChem CID 123566315) has the molecular formula C23H22F3N4O3+ and a molecular weight of 459.45 g/mol. Its IUPAC name is (3S,6S)-4-[5-(2,4-difluorophenyl)-4-fluoro-1,2,5-oxadiazol-5-ium-3-carbonyl]-3-(2-methylpropyl)-6-phenylpiperazin-2-one.
| Compound Name | (3S,6S)-4-[5-(2,4-difluorophenyl)-4-fluoro-1,2,5-oxadiazol-5-ium-3-carbonyl]-3-(2-methylpropyl)-6-phenylpiperazin-2-one |
|---|---|
| PubChem CID | 123566315 |
| Molecular Formula | C23H22F3N4O3+ |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (3S,6S)-4-[5-(2,4-difluorophenyl)-4-fluoro-1,2,5-oxadiazol-5-ium-3-carbonyl]-3-(2-methylpropyl)-6-phenylpiperazin-2-one |
| SMILES | CC(C)C[C@H]1C(=O)N[C@@H](c2ccccc2)CN1C(=O)c1no[n+](-c2ccc(F)cc2F)c1F |
| InChI | InChI=1S/C23H21F3N4O3/c1-13(2)10-19-22(31)27-17(14-6-4-3-5-7-14)12-29(19)23(32)20-21(26)30(33-28-20)18-9-8-15(24)11-16(18)25/h3-9,11,13,17,19H,10,12H2,1-2H3/p+1/t17-,19+/m1/s1 |
| InChIKey | QYHJIAZONCTLDP-MJGOQNOKSA-O |
| XLogP | 3.10 |
| TPSA | 79.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|