About fluorosilylthiourea
fluorosilylthiourea (PubChem CID 123167768) has the molecular formula CH5FN2SSi
and a molecular weight of 124.22 g/mol. Its IUPAC name is fluorosilylthiourea.
Molecular Properties
| Compound Name | fluorosilylthiourea |
| PubChem CID | 123167768 |
| Molecular Formula | CH5FN2SSi |
| Molecular Weight | 124.22 g/mol |
| Exact Mass | 123.99 |
| IUPAC Name | fluorosilylthiourea |
| SMILES | NC(=S)N[SiH2]F |
| InChI | InChI=1S/CH5FN2SSi/c2-6-4-1(3)5/h6H2,(H3,3,4,5) |
| InChIKey | IYOLELHQCGAREL-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.22 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze fluorosilylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorosilylthiourea?
The IUPAC name of fluorosilylthiourea (CID 123167768) is fluorosilylthiourea.
What is the SMILES notation for fluorosilylthiourea?
The canonical SMILES for fluorosilylthiourea is NC(=S)N[SiH2]F.
What is the InChIKey of fluorosilylthiourea?
The InChIKey is IYOLELHQCGAREL-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5FN2SSi/c2-6-4-1(3)5/h6H2,(H3,3,4,5).
What are the key properties of fluorosilylthiourea?
fluorosilylthiourea has a molecular weight of 124.22 g/mol, XLogP of -1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluorosilylthiourea is sourced from PubChem (CID 123167768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).