About dihydroxymethylthiourea
dihydroxymethylthiourea (PubChem CID 141012549) has the molecular formula C2H6N2O2S
and a molecular weight of 122.15 g/mol. Its IUPAC name is dihydroxymethylthiourea.
Molecular Properties
| Compound Name | dihydroxymethylthiourea |
| PubChem CID | 141012549 |
| Molecular Formula | C2H6N2O2S |
| Molecular Weight | 122.15 g/mol |
| Exact Mass | 122.01 |
| IUPAC Name | dihydroxymethylthiourea |
| SMILES | NC(=S)NC(O)O |
| InChI | InChI=1S/C2H6N2O2S/c3-1(7)4-2(5)6/h2,5-6H,(H3,3,4,7) |
| InChIKey | CVVWXNBLGYHJLT-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.15 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dihydroxymethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxymethylthiourea?
The IUPAC name of dihydroxymethylthiourea (CID 141012549) is dihydroxymethylthiourea.
What is the SMILES notation for dihydroxymethylthiourea?
The canonical SMILES for dihydroxymethylthiourea is NC(=S)NC(O)O.
What is the InChIKey of dihydroxymethylthiourea?
The InChIKey is CVVWXNBLGYHJLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O2S/c3-1(7)4-2(5)6/h2,5-6H,(H3,3,4,7).
What are the key properties of dihydroxymethylthiourea?
dihydroxymethylthiourea has a molecular weight of 122.15 g/mol, XLogP of -1.91, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxymethylthiourea is sourced from PubChem (CID 141012549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).