C10H15N3O — CID 123168234
3-(4-ethoxypenta-1,3-dien-2-yl)-4-methyl-1,2,4-triazole (PubChem CID 123168234) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-(4-ethoxypenta-1,3-dien-2-yl)-4-methyl-1,2,4-triazole.
| Compound Name | 3-(4-ethoxypenta-1,3-dien-2-yl)-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 123168234 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-(4-ethoxypenta-1,3-dien-2-yl)-4-methyl-1,2,4-triazole |
| SMILES | C=C(C=C(C)OCC)c1nncn1C |
| InChI | InChI=1S/C10H15N3O/c1-5-14-9(3)6-8(2)10-12-11-7-13(10)4/h6-7H,2,5H2,1,3-4H3 |
| InChIKey | NTQKJWIFAIWVHP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|