About ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate
ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate (PubChem CID 79471932) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate.
Analyze ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate?
The IUPAC name of ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate (CID 79471932) is ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate?
The canonical SMILES for ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate is CCOC(=O)C1(c2nncn2C)CC1.
What is the InChIKey of ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate?
The InChIKey is CKLKQLBDIWCBDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-3-14-8(13)9(4-5-9)7-11-10-6-12(7)2/h6H,3-5H2,1-2H3.
What are the key properties of ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate?
ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate has a molecular weight of 195.22 g/mol, XLogP of 0.41, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(4-methyl-1,2,4-triazol-3-yl)cyclopropane-1-carboxylate is sourced from PubChem (CID 79471932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).