C12H24NO3+ — CID 123168561
2-ethenoxycarbonyloxyethyl-dimethyl-pentylazanium (PubChem CID 123168561) has the molecular formula C12H24NO3+ and a molecular weight of 230.33 g/mol. Its IUPAC name is 2-ethenoxycarbonyloxyethyl-dimethyl-pentylazanium.
| Compound Name | 2-ethenoxycarbonyloxyethyl-dimethyl-pentylazanium |
|---|---|
| PubChem CID | 123168561 |
| Molecular Formula | C12H24NO3+ |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-ethenoxycarbonyloxyethyl-dimethyl-pentylazanium |
| SMILES | C=COC(=O)OCC[N+](C)(C)CCCCC |
| InChI | InChI=1S/C12H24NO3/c1-5-7-8-9-13(3,4)10-11-16-12(14)15-6-2/h6H,2,5,7-11H2,1,3-4H3/q+1 |
| InChIKey | DNFLJVFSGJUBSK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|