C11H17N — CID 123169431
4,5-dimethyl-6-propan-2-yl-4H-azepine (PubChem CID 123169431) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 4,5-dimethyl-6-propan-2-yl-4H-azepine.
| Compound Name | 4,5-dimethyl-6-propan-2-yl-4H-azepine |
|---|---|
| PubChem CID | 123169431 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 4,5-dimethyl-6-propan-2-yl-4H-azepine |
| SMILES | CC1=C(C(C)C)C=NC=CC1C |
| InChI | InChI=1S/C11H17N/c1-8(2)11-7-12-6-5-9(3)10(11)4/h5-9H,1-4H3 |
| InChIKey | HSFOSMYPBMEURQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |