C18H19N2O+ — CID 123171046
2-[2-(2H-azepin-4-yl)ethenyl]-4-(1-methylpyridin-1-ium-3-yl)buta-1,3-dien-1-ol (PubChem CID 123171046) has the molecular formula C18H19N2O+ and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-[2-(2H-azepin-4-yl)ethenyl]-4-(1-methylpyridin-1-ium-3-yl)buta-1,3-dien-1-ol.
| Compound Name | 2-[2-(2H-azepin-4-yl)ethenyl]-4-(1-methylpyridin-1-ium-3-yl)buta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 123171046 |
| Molecular Formula | C18H19N2O+ |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-[2-(2H-azepin-4-yl)ethenyl]-4-(1-methylpyridin-1-ium-3-yl)buta-1,3-dien-1-ol |
| SMILES | C[n+]1cccc(C=CC(C=CC2=CCN=CC=C2)=CO)c1 |
| InChI | InChI=1S/C18H18N2O/c1-20-13-3-5-17(14-20)7-9-18(15-21)8-6-16-4-2-11-19-12-10-16/h2-11,13-15H,12H2,1H3/p+1 |
| InChIKey | HANAFBHIYMQXJD-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 36.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|