C16H13IN2O2 — CID 71966282
4-[(1-methylpyridin-1-ium-3-yl)methylidene]-2-phenyl-1,3-oxazol-5-one iodide (PubChem CID 71966282) has the molecular formula C16H13IN2O2 and a molecular weight of 392.20 g/mol. Its IUPAC name is 4-[(1-methylpyridin-1-ium-3-yl)methylidene]-2-phenyl-1,3-oxazol-5-one iodide.
| Compound Name | 4-[(1-methylpyridin-1-ium-3-yl)methylidene]-2-phenyl-1,3-oxazol-5-one iodide |
|---|---|
| PubChem CID | 71966282 |
| Molecular Formula | C16H13IN2O2 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 4-[(1-methylpyridin-1-ium-3-yl)methylidene]-2-phenyl-1,3-oxazol-5-one iodide |
| SMILES | C[n+]1cccc(C=C2N=C(c3ccccc3)OC2=O)c1.[I-] |
| InChI | InChI=1S/C16H13N2O2.HI/c1-18-9-5-6-12(11-18)10-14-16(19)20-15(17-14)13-7-3-2-4-8-13;/h2-11H,1H3;1H/q+1;/p-1 |
| InChIKey | XHDKPCGZOYBZDX-UHFFFAOYSA-M |
| XLogP | -1.14 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|