C13H11NO — CID 50909041
1-cyclopenta-2,4-dien-1-ylidene-3-pyridin-3-ylprop-2-en-1-ol (PubChem CID 50909041) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-ylidene-3-pyridin-3-ylprop-2-en-1-ol.
| Compound Name | 1-cyclopenta-2,4-dien-1-ylidene-3-pyridin-3-ylprop-2-en-1-ol |
|---|---|
| PubChem CID | 50909041 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-ylidene-3-pyridin-3-ylprop-2-en-1-ol |
| SMILES | OC(C=Cc1cccnc1)=C1C=CC=C1 |
| InChI | InChI=1S/C13H11NO/c15-13(12-5-1-2-6-12)8-7-11-4-3-9-14-10-11/h1-10,15H |
| InChIKey | WPUBGKPVIJJSDD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|