C9H19N — CID 123171488
2,3-dimethyl-1-propan-2-ylcyclobutan-1-amine (PubChem CID 123171488) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is 2,3-dimethyl-1-propan-2-ylcyclobutan-1-amine.
| Compound Name | 2,3-dimethyl-1-propan-2-ylcyclobutan-1-amine |
|---|---|
| PubChem CID | 123171488 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 2,3-dimethyl-1-propan-2-ylcyclobutan-1-amine |
| SMILES | CC1CC(N)(C(C)C)C1C |
| InChI | InChI=1S/C9H19N/c1-6(2)9(10)5-7(3)8(9)4/h6-8H,5,10H2,1-4H3 |
| InChIKey | YIXZKIFXTZONBE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |