C26H33N3O7 — CID 123172220
2-[[3-[[(2R)-2-(but-2-ynoylamino)-3-cyclohexylpropanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetic acid (PubChem CID 123172220) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is 2-[[3-[[(2R)-2-(but-2-ynoylamino)-3-cyclohexylpropanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetic acid.
| Compound Name | 2-[[3-[[(2R)-2-(but-2-ynoylamino)-3-cyclohexylpropanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 123172220 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 2-[[3-[[(2R)-2-(but-2-ynoylamino)-3-cyclohexylpropanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetic acid |
| SMILES | CC#CC(=O)N[C@H](CC1CCCCC1)C(=O)NC(COCc1ccccc1)C(=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C26H33N3O7/c1-2-9-22(30)28-20(14-18-10-5-3-6-11-18)25(34)29-21(24(33)26(35)27-15-23(31)32)17-36-16-19-12-7-4-8-13-19/h4,7-8,12-13,18,20-21H,3,5-6,10-11,14-17H2,1H3,(H,27,35)(H,28,30)(H,29,34)(H,31,32)/t20-,21?/m1/s1 |
| InChIKey | FPGUIBUGIRPAOP-VQCQRNETSA-N |
| XLogP | 0.94 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|