C38H45N3O7 — CID 53240681
ethyl 2-[[(3S)-3-[[(2R)-2-[(2-benzylbenzoyl)amino]-3-cyclohexylpropanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate (PubChem CID 53240681) has the molecular formula C38H45N3O7 and a molecular weight of 655.79 g/mol. Its IUPAC name is ethyl 2-[[(3S)-3-[[(2R)-2-[(2-benzylbenzoyl)amino]-3-cyclohexylpropanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate.
| Compound Name | ethyl 2-[[(3S)-3-[[(2R)-2-[(2-benzylbenzoyl)amino]-3-cyclohexylpropanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate |
|---|---|
| PubChem CID | 53240681 |
| Molecular Formula | C38H45N3O7 |
| Molecular Weight | 655.79 g/mol |
| Exact Mass | 655.33 |
| IUPAC Name | ethyl 2-[[(3S)-3-[[(2R)-2-[(2-benzylbenzoyl)amino]-3-cyclohexylpropanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C(=O)[C@H](COCc1ccccc1)NC(=O)[C@@H](CC1CCCCC1)NC(=O)c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C38H45N3O7/c1-2-48-34(42)24-39-38(46)35(43)33(26-47-25-29-18-10-5-11-19-29)41-37(45)32(23-28-16-8-4-9-17-28)40-36(44)31-21-13-12-20-30(31)22-27-14-6-3-7-15-27/h3,5-7,10-15,18-21,28,32-33H,2,4,8-9,16-17,22-26H2,1H3,(H,39,46)(H,40,44)(H,41,45)/t32-,33+/m1/s1 |
| InChIKey | JNIHAUHFUWJCKZ-SAIUNTKASA-N |
| XLogP | 4.30 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.79 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|