C32H40N4O10 — CID 53240679
ethyl 2-[[(3S)-3-[[(2R)-3-cyclohexyl-2-[(5-methoxy-2-nitrobenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate (PubChem CID 53240679) has the molecular formula C32H40N4O10 and a molecular weight of 640.69 g/mol. Its IUPAC name is ethyl 2-[[(3S)-3-[[(2R)-3-cyclohexyl-2-[(5-methoxy-2-nitrobenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate.
| Compound Name | ethyl 2-[[(3S)-3-[[(2R)-3-cyclohexyl-2-[(5-methoxy-2-nitrobenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate |
|---|---|
| PubChem CID | 53240679 |
| Molecular Formula | C32H40N4O10 |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | ethyl 2-[[(3S)-3-[[(2R)-3-cyclohexyl-2-[(5-methoxy-2-nitrobenzoyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C(=O)[C@H](COCc1ccccc1)NC(=O)[C@@H](CC1CCCCC1)NC(=O)c1cc(OC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H40N4O10/c1-3-46-28(37)18-33-32(41)29(38)26(20-45-19-22-12-8-5-9-13-22)35-31(40)25(16-21-10-6-4-7-11-21)34-30(39)24-17-23(44-2)14-15-27(24)36(42)43/h5,8-9,12-15,17,21,25-26H,3-4,6-7,10-11,16,18-20H2,1-2H3,(H,33,41)(H,34,39)(H,35,40)/t25-,26+/m1/s1 |
| InChIKey | FONWUYJGUQSIGZ-FTJBHMTQSA-N |
| XLogP | 2.62 |
| TPSA | 192.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|