C6H9Cl2N — CID 123172756
(Z)-1,5-dichlorohex-3-en-2-imine (PubChem CID 123172756) has the molecular formula C6H9Cl2N and a molecular weight of 166.05 g/mol. Its IUPAC name is (Z)-1,5-dichlorohex-3-en-2-imine.
| Compound Name | (Z)-1,5-dichlorohex-3-en-2-imine |
|---|---|
| PubChem CID | 123172756 |
| Molecular Formula | C6H9Cl2N |
| Molecular Weight | 166.05 g/mol |
| Exact Mass | 165.01 |
| IUPAC Name | (Z)-1,5-dichlorohex-3-en-2-imine |
| SMILES | [H]/N=C(/C=C\C(C)Cl)CCl |
| InChI | InChI=1S/C6H9Cl2N/c1-5(8)2-3-6(9)4-7/h2-3,5,9H,4H2,1H3/b3-2-,9-6- |
| InChIKey | MORQZTSMPDPNER-CITLEARMSA-N |
| XLogP | 2.43 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.05 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|