C14H22N8 — CID 123173540
3-[4-(2-cyanoethyl)piperazin-1-yl]-3-imino-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide (PubChem CID 123173540) has the molecular formula C14H22N8 and a molecular weight of 302.39 g/mol. Its IUPAC name is 3-[4-(2-cyanoethyl)piperazin-1-yl]-3-imino-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide.
| Compound Name | 3-[4-(2-cyanoethyl)piperazin-1-yl]-3-imino-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
|---|---|
| PubChem CID | 123173540 |
| Molecular Formula | C14H22N8 |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 3-[4-(2-cyanoethyl)piperazin-1-yl]-3-imino-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
| SMILES | [H]/N=C(\C/C(N)=N/c1cc(C)[nH]n1)N1CCN(CCC#N)CC1 |
| InChI | InChI=1S/C14H22N8/c1-11-9-14(20-19-11)18-12(16)10-13(17)22-7-5-21(6-8-22)4-2-3-15/h9,17H,2,4-8,10H2,1H3,(H3,16,18,19,20)/b17-13+ |
| InChIKey | CPCJNFXXWPAKNP-GHRIWEEISA-N |
| XLogP | 0.61 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|