C34H42BN3O5 — CID 123174338
tert-butyl N-[2-methyl-4-[17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-5,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),2,4(8),5,9,11,14(19),15,17-nonaen-6-yl]butyl]carbamate (PubChem CID 123174338) has the molecular formula C34H42BN3O5 and a molecular weight of 583.54 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-4-[17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-5,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),2,4(8),5,9,11,14(19),15,17-nonaen-6-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-4-[17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-5,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),2,4(8),5,9,11,14(19),15,17-nonaen-6-yl]butyl]carbamate |
|---|---|
| PubChem CID | 123174338 |
| Molecular Formula | C34H42BN3O5 |
| Molecular Weight | 583.54 g/mol |
| Exact Mass | 583.32 |
| IUPAC Name | tert-butyl N-[2-methyl-4-[17-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-5,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),2,4(8),5,9,11,14(19),15,17-nonaen-6-yl]butyl]carbamate |
| SMILES | CC(CCc1nc2c(ccc3cc4c(cc32)OCc2cc(B3OC(C)(C)C(C)(C)O3)ccc2-4)[nH]1)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H42BN3O5/c1-20(18-36-31(39)41-32(2,3)4)9-14-29-37-27-13-10-21-16-26-24-12-11-23(35-42-33(5,6)34(7,8)43-35)15-22(24)19-40-28(26)17-25(21)30(27)38-29/h10-13,15-17,20H,9,14,18-19H2,1-8H3,(H,36,39)(H,37,38) |
| InChIKey | HRGVYOZAQVUTFE-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.54 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|