C11H13Cl2N — CID 123174544
N-(2,6-dichlorophenyl)pentan-2-imine (PubChem CID 123174544) has the molecular formula C11H13Cl2N and a molecular weight of 230.14 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)pentan-2-imine.
| Compound Name | N-(2,6-dichlorophenyl)pentan-2-imine |
|---|---|
| PubChem CID | 123174544 |
| Molecular Formula | C11H13Cl2N |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | N-(2,6-dichlorophenyl)pentan-2-imine |
| SMILES | CCC/C(C)=N/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13Cl2N/c1-3-5-8(2)14-11-9(12)6-4-7-10(11)13/h4,6-7H,3,5H2,1-2H3/b14-8+ |
| InChIKey | HWZMWIBEJZNQPB-RIYZIHGNSA-N |
| XLogP | 4.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|