C15H27FOSi — CID 123175134
tert-butyl-(3-fluorocyclonona-3,5-dien-1-yl)oxy-dimethylsilane (PubChem CID 123175134) has the molecular formula C15H27FOSi and a molecular weight of 270.46 g/mol. Its IUPAC name is tert-butyl-(3-fluorocyclonona-3,5-dien-1-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(3-fluorocyclonona-3,5-dien-1-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 123175134 |
| Molecular Formula | C15H27FOSi |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | tert-butyl-(3-fluorocyclonona-3,5-dien-1-yl)oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC=CC=C(F)C1 |
| InChI | InChI=1S/C15H27FOSi/c1-15(2,3)18(4,5)17-14-11-9-7-6-8-10-13(16)12-14/h6,8,10,14H,7,9,11-12H2,1-5H3 |
| InChIKey | OXFINUQOVHOYPU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|