C18H32OSi — CID 139250259
tert-butyl-[(3E,9E)-dodeca-1,3,9,11-tetraen-6-yl]oxy-dimethylsilane (PubChem CID 139250259) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is tert-butyl-[(3E,9E)-dodeca-1,3,9,11-tetraen-6-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3E,9E)-dodeca-1,3,9,11-tetraen-6-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 139250259 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | tert-butyl-[(3E,9E)-dodeca-1,3,9,11-tetraen-6-yl]oxy-dimethylsilane |
| SMILES | C=C/C=C/CCC(C/C=C/C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32OSi/c1-8-10-12-14-16-17(15-13-11-9-2)19-20(6,7)18(3,4)5/h8-13,17H,1-2,14-16H2,3-7H3/b12-10+,13-11+ |
| InChIKey | WGXWURMHLZRLME-DCIPZJNNSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|