C34H36F2N6O5Si — CID 123176252
[2-[5-amino-1-[6-(2,3-difluorophenoxy)-3-pyridinyl]pyrazole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)indol-5-yl]-morpholin-4-ylmethanone (PubChem CID 123176252) has the molecular formula C34H36F2N6O5Si and a molecular weight of 674.78 g/mol. Its IUPAC name is [2-[5-amino-1-[6-(2,3-difluorophenoxy)-3-pyridinyl]pyrazole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)indol-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-[5-amino-1-[6-(2,3-difluorophenoxy)-3-pyridinyl]pyrazole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)indol-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 123176252 |
| Molecular Formula | C34H36F2N6O5Si |
| Molecular Weight | 674.78 g/mol |
| Exact Mass | 674.25 |
| IUPAC Name | [2-[5-amino-1-[6-(2,3-difluorophenoxy)-3-pyridinyl]pyrazole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)indol-5-yl]-morpholin-4-ylmethanone |
| SMILES | C[Si](C)(C)CCOCn1c(C(=O)c2cnn(-c3ccc(Oc4cccc(F)c4F)nc3)c2N)cc2cc(C(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C34H36F2N6O5Si/c1-48(2,3)16-15-46-21-41-27-9-7-22(34(44)40-11-13-45-14-12-40)17-23(27)18-28(41)32(43)25-20-39-42(33(25)37)24-8-10-30(38-19-24)47-29-6-4-5-26(35)31(29)36/h4-10,17-20H,11-16,21,37H2,1-3H3 |
| InChIKey | KRVWHGYOEMOBNR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.78 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|