C35H38FN5O5Si — CID 123495312
[2-[5-amino-1-(2-fluoro-4-phenoxyphenyl)pyrazole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)indol-5-yl]-morpholin-4-ylmethanone (PubChem CID 123495312) has the molecular formula C35H38FN5O5Si and a molecular weight of 655.80 g/mol. Its IUPAC name is [2-[5-amino-1-(2-fluoro-4-phenoxyphenyl)pyrazole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)indol-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-[5-amino-1-(2-fluoro-4-phenoxyphenyl)pyrazole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)indol-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 123495312 |
| Molecular Formula | C35H38FN5O5Si |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | [2-[5-amino-1-(2-fluoro-4-phenoxyphenyl)pyrazole-4-carbonyl]-1-(2-trimethylsilylethoxymethyl)indol-5-yl]-morpholin-4-ylmethanone |
| SMILES | C[Si](C)(C)CCOCn1c(C(=O)c2cnn(-c3ccc(Oc4ccccc4)cc3F)c2N)cc2cc(C(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C35H38FN5O5Si/c1-47(2,3)18-17-45-23-40-30-11-9-24(35(43)39-13-15-44-16-14-39)19-25(30)20-32(40)33(42)28-22-38-41(34(28)37)31-12-10-27(21-29(31)36)46-26-7-5-4-6-8-26/h4-12,19-22H,13-18,23,37H2,1-3H3 |
| InChIKey | QAJWCWSKQAHDRE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|